C26H29F2NO2S2 — CID 91210974
5-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-4-hydroxy-3H-1,3-thiazole-2-thione (PubChem CID 91210974) has the molecular formula C26H29F2NO2S2 and a molecular weight of 489.65 g/mol. Its IUPAC name is 5-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-4-hydroxy-3H-1,3-thiazole-2-thione.
| Compound Name | 5-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-4-hydroxy-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 91210974 |
| Molecular Formula | C26H29F2NO2S2 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 5-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-4-hydroxy-3H-1,3-thiazole-2-thione |
| SMILES | COc1c(F)cc(Cc2sc(=S)[nH]c2O)c(F)c1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H29F2NO2S2/c1-13-9-16-17(26(4,5)8-7-25(16,2)3)12-15(13)20-21(28)14(10-18(27)22(20)31-6)11-19-23(30)29-24(32)33-19/h9-10,12,30H,7-8,11H2,1-6H3,(H,29,32) |
| InChIKey | QEHSYDJHVDCFBQ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|