C10H5F2NOS2 — CID 75267623
5-[(2,5-difluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 75267623) has the molecular formula C10H5F2NOS2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2,5-difluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 75267623 |
| Molecular Formula | C10H5F2NOS2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 5-[(2,5-difluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)SC1=Cc1cc(F)ccc1F |
| InChI | InChI=1S/C10H5F2NOS2/c11-6-1-2-7(12)5(3-6)4-8-9(14)13-10(15)16-8/h1-4H,(H,13,14,15) |
| InChIKey | QEWKRKYLGUETOU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|