C16H9F2NOS2 — CID 25067908
(5Z)-5-[[4-(3,4-difluorophenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 25067908) has the molecular formula C16H9F2NOS2 and a molecular weight of 333.38 g/mol. Its IUPAC name is (5Z)-5-[[4-(3,4-difluorophenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(3,4-difluorophenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 25067908 |
| Molecular Formula | C16H9F2NOS2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | (5Z)-5-[[4-(3,4-difluorophenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1ccc(-c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H9F2NOS2/c17-12-6-5-11(8-13(12)18)10-3-1-9(2-4-10)7-14-15(20)19-16(21)22-14/h1-8H,(H,19,20,21)/b14-7- |
| InChIKey | CKCLDRPRGOQJIM-AUWJEWJLSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|