C16H9ClFNO2S — CID 25068029
(5Z)-5-[[4-(3-chloro-4-fluorophenyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25068029) has the molecular formula C16H9ClFNO2S and a molecular weight of 333.77 g/mol. Its IUPAC name is (5Z)-5-[[4-(3-chloro-4-fluorophenyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(3-chloro-4-fluorophenyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25068029 |
| Molecular Formula | C16H9ClFNO2S |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | (5Z)-5-[[4-(3-chloro-4-fluorophenyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(-c3ccc(F)c(Cl)c3)cc2)S1 |
| InChI | InChI=1S/C16H9ClFNO2S/c17-12-8-11(5-6-13(12)18)10-3-1-9(2-4-10)7-14-15(20)19-16(21)22-14/h1-8H,(H,19,20,21)/b14-7- |
| InChIKey | KALQUHMXFRLVIR-AUWJEWJLSA-N |
| XLogP | 4.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|