C17H8ClF4NO3S — CID 87380959
(5E)-5-[[4-[4-chloro-2-(trifluoromethyl)phenoxy]-3-fluorophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87380959) has the molecular formula C17H8ClF4NO3S and a molecular weight of 417.77 g/mol. Its IUPAC name is (5E)-5-[[4-[4-chloro-2-(trifluoromethyl)phenoxy]-3-fluorophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[4-chloro-2-(trifluoromethyl)phenoxy]-3-fluorophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87380959 |
| Molecular Formula | C17H8ClF4NO3S |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | (5E)-5-[[4-[4-chloro-2-(trifluoromethyl)phenoxy]-3-fluorophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc(Oc3ccc(Cl)cc3C(F)(F)F)c(F)c2)S1 |
| InChI | InChI=1S/C17H8ClF4NO3S/c18-9-2-4-12(10(7-9)17(20,21)22)26-13-3-1-8(5-11(13)19)6-14-15(24)23-16(25)27-14/h1-7H,(H,23,24,25)/b14-6+ |
| InChIKey | MLAIMOKYRNFOKJ-MKMNVTDBSA-N |
| XLogP | 5.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|