C19H11F3N2O3S2 — CID 86623142
4-[2-methoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 86623142) has the molecular formula C19H11F3N2O3S2 and a molecular weight of 436.44 g/mol. Its IUPAC name is 4-[2-methoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2-methoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 86623142 |
| Molecular Formula | C19H11F3N2O3S2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 4-[2-methoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(C=C2SC(=S)NC2=O)ccc1Oc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C19H11F3N2O3S2/c1-26-15-7-10(8-16-17(25)24-18(28)29-16)2-5-14(15)27-13-4-3-11(9-23)6-12(13)19(20,21)22/h2-8H,1H3,(H,24,25,28) |
| InChIKey | WNPYXBRMLPKOJL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|