C23H19F3N4O4S — CID 136653311
N-[2-[[5-[[4-[4-cyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]ethyl]acetamide (PubChem CID 136653311) has the molecular formula C23H19F3N4O4S and a molecular weight of 504.49 g/mol. Its IUPAC name is N-[2-[[5-[[4-[4-cyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]ethyl]acetamide.
| Compound Name | N-[2-[[5-[[4-[4-cyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 136653311 |
| Molecular Formula | C23H19F3N4O4S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | N-[2-[[5-[[4-[4-cyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]ethyl]acetamide |
| SMILES | COc1cc(C=C2S/C(=N\CCNC(C)=O)NC2=O)ccc1Oc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C23H19F3N4O4S/c1-13(31)28-7-8-29-22-30-21(32)20(35-22)11-14-3-6-18(19(10-14)33-2)34-17-5-4-15(12-27)9-16(17)23(24,25)26/h3-6,9-11H,7-8H2,1-2H3,(H,28,31)(H,29,30,32) |
| InChIKey | ZLNZWPYTXVFAQM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|