C25H22F3N5O4S — CID 136608892
4-[2-hydroxy-4-[(Z)-[4-oxo-2-[3-(3-oxopiperazin-1-yl)propylimino]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 136608892) has the molecular formula C25H22F3N5O4S and a molecular weight of 545.54 g/mol. Its IUPAC name is 4-[2-hydroxy-4-[(Z)-[4-oxo-2-[3-(3-oxopiperazin-1-yl)propylimino]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2-hydroxy-4-[(Z)-[4-oxo-2-[3-(3-oxopiperazin-1-yl)propylimino]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 136608892 |
| Molecular Formula | C25H22F3N5O4S |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 4-[2-hydroxy-4-[(Z)-[4-oxo-2-[3-(3-oxopiperazin-1-yl)propylimino]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(/C=C3\S/C(=N/CCCN4CCNC(=O)C4)NC3=O)cc2O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22F3N5O4S/c26-25(27,28)17-10-16(13-29)3-4-19(17)37-20-5-2-15(11-18(20)34)12-21-23(36)32-24(38-21)31-6-1-8-33-9-7-30-22(35)14-33/h2-5,10-12,34H,1,6-9,14H2,(H,30,35)(H,31,32,36)/b21-12- |
| InChIKey | GNZMJTXAMVHKBB-MTJSOVHGSA-N |
| XLogP | 3.46 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|