C24H20F3N3O5S — CID 87664776
4-[2-hydroxy-4-[(Z)-[3-(2-morpholin-4-ylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 87664776) has the molecular formula C24H20F3N3O5S and a molecular weight of 519.50 g/mol. Its IUPAC name is 4-[2-hydroxy-4-[(Z)-[3-(2-morpholin-4-ylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2-hydroxy-4-[(Z)-[3-(2-morpholin-4-ylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 87664776 |
| Molecular Formula | C24H20F3N3O5S |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 4-[2-hydroxy-4-[(Z)-[3-(2-morpholin-4-ylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(/C=C3\SC(=O)N(CCN4CCOCC4)C3=O)cc2O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F3N3O5S/c25-24(26,27)17-11-16(14-28)2-3-19(17)35-20-4-1-15(12-18(20)31)13-21-22(32)30(23(33)36-21)6-5-29-7-9-34-10-8-29/h1-4,11-13,31H,5-10H2/b21-13- |
| InChIKey | VUMXSMCUXILPNS-BKUYFWCQSA-N |
| XLogP | 4.44 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|