C29H23BrF3N3O4 — CID 156695710
4-[4-[[4-bromo-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-3-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 156695710) has the molecular formula C29H23BrF3N3O4 and a molecular weight of 614.42 g/mol. Its IUPAC name is 4-[4-[[4-bromo-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-3-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[[4-bromo-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-3-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 156695710 |
| Molecular Formula | C29H23BrF3N3O4 |
| Molecular Weight | 614.42 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | 4-[4-[[4-bromo-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-3-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(C=C3C(=O)N(CCN4CCOCC4)c4cccc(Br)c43)c(O)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H23BrF3N3O4/c30-23-2-1-3-24-27(23)21(28(38)36(24)9-8-35-10-12-39-13-11-35)15-19-5-6-20(16-25(19)37)40-26-7-4-18(17-34)14-22(26)29(31,32)33/h1-7,14-16,37H,8-13H2 |
| InChIKey | XTJNFYHJFKGCNW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|