C24H16F3N3O4S — CID 88571699
4-[4-[(Z)-[2,4-dioxo-3-(2-pyrrol-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 88571699) has the molecular formula C24H16F3N3O4S and a molecular weight of 499.47 g/mol. Its IUPAC name is 4-[4-[(Z)-[2,4-dioxo-3-(2-pyrrol-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(Z)-[2,4-dioxo-3-(2-pyrrol-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 88571699 |
| Molecular Formula | C24H16F3N3O4S |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 4-[4-[(Z)-[2,4-dioxo-3-(2-pyrrol-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(/C=C3\SC(=O)N(CCn4cccc4)C3=O)cc2O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H16F3N3O4S/c25-24(26,27)17-11-16(14-28)4-5-19(17)34-20-6-3-15(12-18(20)31)13-21-22(32)30(23(33)35-21)10-9-29-7-1-2-8-29/h1-8,11-13,31H,9-10H2/b21-13- |
| InChIKey | PGNWDEOHEGGWBO-BKUYFWCQSA-N |
| XLogP | 5.61 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|