C13H11N3O2S — CID 43145553
3-[(Z)-[3-(2-aminoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzonitrile (PubChem CID 43145553) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 3-[(Z)-[3-(2-aminoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzonitrile.
| Compound Name | 3-[(Z)-[3-(2-aminoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 43145553 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-[(Z)-[3-(2-aminoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzonitrile |
| SMILES | N#Cc1cccc(/C=C2\SC(=O)N(CCN)C2=O)c1 |
| InChI | InChI=1S/C13H11N3O2S/c14-4-5-16-12(17)11(19-13(16)18)7-9-2-1-3-10(6-9)8-15/h1-3,6-7H,4-5,14H2/b11-7- |
| InChIKey | CHOYDIWLOLEBOH-XFFZJAGNSA-N |
| XLogP | 1.55 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|