C14H10N2OS2 — CID 51322160
3-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzonitrile (PubChem CID 51322160) has the molecular formula C14H10N2OS2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzonitrile.
| Compound Name | 3-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzonitrile |
|---|---|
| PubChem CID | 51322160 |
| Molecular Formula | C14H10N2OS2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 3-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzonitrile |
| SMILES | C=CCN1C(=O)/C(=C/c2cccc(C#N)c2)SC1=S |
| InChI | InChI=1S/C14H10N2OS2/c1-2-6-16-13(17)12(19-14(16)18)8-10-4-3-5-11(7-10)9-15/h2-5,7-8H,1,6H2/b12-8- |
| InChIKey | YJSULQAMQYORDG-WQLSENKSSA-N |
| XLogP | 2.95 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|