C26H24F3N3O4S — CID 25009360
4-[4-[(Z)-[2,4-dioxo-3-(2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 25009360) has the molecular formula C26H24F3N3O4S and a molecular weight of 531.56 g/mol. Its IUPAC name is 4-[4-[(Z)-[2,4-dioxo-3-(2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(Z)-[2,4-dioxo-3-(2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 25009360 |
| Molecular Formula | C26H24F3N3O4S |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 4-[4-[(Z)-[2,4-dioxo-3-(2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(/C=C2\SC(=O)N(CCN3CCCCC3)C2=O)ccc1Oc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C26H24F3N3O4S/c1-35-22-14-17(5-8-21(22)36-20-7-6-18(16-30)13-19(20)26(27,28)29)15-23-24(33)32(25(34)37-23)12-11-31-9-3-2-4-10-31/h5-8,13-15H,2-4,9-12H2,1H3/b23-15- |
| InChIKey | NPUNYRATWGPIJY-HAHDFKILSA-N |
| XLogP | 5.90 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|