C19H12F3N3O3S — CID 173132538
4-[4-[(E)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 173132538) has the molecular formula C19H12F3N3O3S and a molecular weight of 419.38 g/mol. Its IUPAC name is 4-[4-[(E)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(E)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 173132538 |
| Molecular Formula | C19H12F3N3O3S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 4-[4-[(E)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | [H]/N=C1/NC(=O)/C(=C\c2ccc(Oc3ccc(C#N)cc3C(F)(F)F)c(OC)c2)S1 |
| InChI | InChI=1S/C19H12F3N3O3S/c1-27-15-7-10(8-16-17(26)25-18(24)29-16)2-5-14(15)28-13-4-3-11(9-23)6-12(13)19(20,21)22/h2-8H,1H3,(H2,24,25,26)/b16-8+ |
| InChIKey | UJLLZGIBDWGYJF-LZYBPNLTSA-N |
| XLogP | 4.52 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|