C27H26F3N3O4S — CID 25116811
4-[4-[(Z)-[3-[2-(azepan-1-yl)ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 25116811) has the molecular formula C27H26F3N3O4S and a molecular weight of 545.58 g/mol. Its IUPAC name is 4-[4-[(Z)-[3-[2-(azepan-1-yl)ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(Z)-[3-[2-(azepan-1-yl)ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 25116811 |
| Molecular Formula | C27H26F3N3O4S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 4-[4-[(Z)-[3-[2-(azepan-1-yl)ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(/C=C2\SC(=O)N(CCN3CCCCCC3)C2=O)ccc1Oc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C27H26F3N3O4S/c1-36-23-15-18(6-9-22(23)37-21-8-7-19(17-31)14-20(21)27(28,29)30)16-24-25(34)33(26(35)38-24)13-12-32-10-4-2-3-5-11-32/h6-9,14-16H,2-5,10-13H2,1H3/b24-16- |
| InChIKey | BABRIBMDAFGENJ-JLPGSUDCSA-N |
| XLogP | 6.29 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|