C23H20F3N3O4S — CID 74387774
4-[4-[[3-[2-(dimethylamino)ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 74387774) has the molecular formula C23H20F3N3O4S and a molecular weight of 491.49 g/mol. Its IUPAC name is 4-[4-[[3-[2-(dimethylamino)ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[[3-[2-(dimethylamino)ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 74387774 |
| Molecular Formula | C23H20F3N3O4S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 4-[4-[[3-[2-(dimethylamino)ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(C=C2SC(=O)N(CCN(C)C)C2=O)ccc1Oc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C23H20F3N3O4S/c1-28(2)8-9-29-21(30)20(34-22(29)31)12-14-4-7-18(19(11-14)32-3)33-17-6-5-15(13-27)10-16(17)23(24,25)26/h4-7,10-12H,8-9H2,1-3H3 |
| InChIKey | ZGAXJISLWBXZHC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|