C25H22F3N5O6S — CID 123838817
(5Z)-3-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-5-[[4-[4-isocyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123838817) has the molecular formula C25H22F3N5O6S and a molecular weight of 577.54 g/mol. Its IUPAC name is (5Z)-3-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-5-[[4-[4-isocyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-5-[[4-[4-isocyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123838817 |
| Molecular Formula | C25H22F3N5O6S |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | (5Z)-3-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-5-[[4-[4-isocyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(/C=C3\SC(=O)N(CCOCCOCCN=[N+]=[N-])C3=O)cc2OC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22F3N5O6S/c1-30-17-4-6-19(18(15-17)25(26,27)28)39-20-5-3-16(13-21(20)36-2)14-22-23(34)33(24(35)40-22)8-10-38-12-11-37-9-7-31-32-29/h3-6,13-15H,7-12H2,2H3/b22-14- |
| InChIKey | MPMGJVOLHDIKLA-HMAPJEAMSA-N |
| XLogP | 6.44 |
| TPSA | 127.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|