C21H13F3N2O6S — CID 118881658
2-[(5Z)-5-[[4-[4-cyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 118881658) has the molecular formula C21H13F3N2O6S and a molecular weight of 478.40 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[4-cyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[4-[4-cyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 118881658 |
| Molecular Formula | C21H13F3N2O6S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 2-[(5Z)-5-[[4-[4-cyano-2-(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)O)C2=O)ccc1Oc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C21H13F3N2O6S/c1-31-16-7-11(8-17-19(29)26(10-18(27)28)20(30)33-17)2-5-15(16)32-14-4-3-12(9-25)6-13(14)21(22,23)24/h2-8H,10H2,1H3,(H,27,28)/b17-8- |
| InChIKey | LJVYOYSFXQWZQS-IUXPMGMMSA-N |
| XLogP | 4.50 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|