C32H29F4N3O3 — CID 156695722
4-[4-[[5-fluoro-2-oxo-1-(3-piperidin-1-ylpropyl)indol-3-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 156695722) has the molecular formula C32H29F4N3O3 and a molecular weight of 579.59 g/mol. Its IUPAC name is 4-[4-[[5-fluoro-2-oxo-1-(3-piperidin-1-ylpropyl)indol-3-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[[5-fluoro-2-oxo-1-(3-piperidin-1-ylpropyl)indol-3-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 156695722 |
| Molecular Formula | C32H29F4N3O3 |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 4-[4-[[5-fluoro-2-oxo-1-(3-piperidin-1-ylpropyl)indol-3-ylidene]methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(C=C2C(=O)N(CCCN3CCCCC3)c3ccc(F)cc32)ccc1Oc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C32H29F4N3O3/c1-41-30-18-21(6-11-29(30)42-28-10-7-22(20-37)17-26(28)32(34,35)36)16-25-24-19-23(33)8-9-27(24)39(31(25)40)15-5-14-38-12-3-2-4-13-38/h6-11,16-19H,2-5,12-15H2,1H3 |
| InChIKey | RCNRHXHURBQIEZ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|