C28H24Cl2FN3O6 — CID 156695737
3-[[4-(2,6-dichloro-4-nitrophenoxy)-3-methoxyphenyl]methylidene]-5-fluoro-1-(2-morpholin-4-ylethyl)indol-2-one (PubChem CID 156695737) has the molecular formula C28H24Cl2FN3O6 and a molecular weight of 588.42 g/mol. Its IUPAC name is 3-[[4-(2,6-dichloro-4-nitrophenoxy)-3-methoxyphenyl]methylidene]-5-fluoro-1-(2-morpholin-4-ylethyl)indol-2-one.
| Compound Name | 3-[[4-(2,6-dichloro-4-nitrophenoxy)-3-methoxyphenyl]methylidene]-5-fluoro-1-(2-morpholin-4-ylethyl)indol-2-one |
|---|---|
| PubChem CID | 156695737 |
| Molecular Formula | C28H24Cl2FN3O6 |
| Molecular Weight | 588.42 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | 3-[[4-(2,6-dichloro-4-nitrophenoxy)-3-methoxyphenyl]methylidene]-5-fluoro-1-(2-morpholin-4-ylethyl)indol-2-one |
| SMILES | COc1cc(C=C2C(=O)N(CCN3CCOCC3)c3ccc(F)cc32)ccc1Oc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C28H24Cl2FN3O6/c1-38-26-13-17(2-5-25(26)40-27-22(29)15-19(34(36)37)16-23(27)30)12-21-20-14-18(31)3-4-24(20)33(28(21)35)7-6-32-8-10-39-11-9-32/h2-5,12-16H,6-11H2,1H3 |
| InChIKey | FNWKSYVCLKRFAM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 94.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|