C29H27ClFN3O7 — CID 156695734
3-[[4-(2-chloro-5-methoxy-4-nitrophenoxy)-3-methoxyphenyl]methylidene]-5-fluoro-1-(2-morpholin-4-ylethyl)indol-2-one (PubChem CID 156695734) has the molecular formula C29H27ClFN3O7 and a molecular weight of 584.00 g/mol. Its IUPAC name is 3-[[4-(2-chloro-5-methoxy-4-nitrophenoxy)-3-methoxyphenyl]methylidene]-5-fluoro-1-(2-morpholin-4-ylethyl)indol-2-one.
| Compound Name | 3-[[4-(2-chloro-5-methoxy-4-nitrophenoxy)-3-methoxyphenyl]methylidene]-5-fluoro-1-(2-morpholin-4-ylethyl)indol-2-one |
|---|---|
| PubChem CID | 156695734 |
| Molecular Formula | C29H27ClFN3O7 |
| Molecular Weight | 584.00 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 3-[[4-(2-chloro-5-methoxy-4-nitrophenoxy)-3-methoxyphenyl]methylidene]-5-fluoro-1-(2-morpholin-4-ylethyl)indol-2-one |
| SMILES | COc1cc(C=C2C(=O)N(CCN3CCOCC3)c3ccc(F)cc32)ccc1Oc1cc(OC)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C29H27ClFN3O7/c1-38-27-17-26(22(30)16-24(27)34(36)37)41-25-6-3-18(14-28(25)39-2)13-21-20-15-19(31)4-5-23(20)33(29(21)35)8-7-32-9-11-40-12-10-32/h3-6,13-17H,7-12H2,1-2H3 |
| InChIKey | JCGSPDAPVVBVHZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 103.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.00 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|