C23H30N2O7 — CID 170869403
4-[3-[4,5-dimethoxy-2-(2-methoxy-5-methyl-4-nitrophenoxy)phenyl]propyl]morpholine (PubChem CID 170869403) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is 4-[3-[4,5-dimethoxy-2-(2-methoxy-5-methyl-4-nitrophenoxy)phenyl]propyl]morpholine.
| Compound Name | 4-[3-[4,5-dimethoxy-2-(2-methoxy-5-methyl-4-nitrophenoxy)phenyl]propyl]morpholine |
|---|---|
| PubChem CID | 170869403 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 4-[3-[4,5-dimethoxy-2-(2-methoxy-5-methyl-4-nitrophenoxy)phenyl]propyl]morpholine |
| SMILES | COc1cc(CCCN2CCOCC2)c(Oc2cc(C)c([N+](=O)[O-])cc2OC)cc1OC |
| InChI | InChI=1S/C23H30N2O7/c1-16-12-23(21(29-3)14-18(16)25(26)27)32-19-15-22(30-4)20(28-2)13-17(19)6-5-7-24-8-10-31-11-9-24/h12-15H,5-11H2,1-4H3 |
| InChIKey | FNEMVVSLPHVUDZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|