C15H23N3O4 — CID 112720390
1-[3-(4,5-dimethoxy-2-nitrophenyl)propyl]piperazine (PubChem CID 112720390) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-[3-(4,5-dimethoxy-2-nitrophenyl)propyl]piperazine.
| Compound Name | 1-[3-(4,5-dimethoxy-2-nitrophenyl)propyl]piperazine |
|---|---|
| PubChem CID | 112720390 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-[3-(4,5-dimethoxy-2-nitrophenyl)propyl]piperazine |
| SMILES | COc1cc(CCCN2CCNCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H23N3O4/c1-21-14-10-12(13(18(19)20)11-15(14)22-2)4-3-7-17-8-5-16-6-9-17/h10-11,16H,3-9H2,1-2H3 |
| InChIKey | DMMCJCAAPNRSAO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|