C18H29N3O4 — CID 171311221
1-[(1R)-1-(4,5-dimethoxy-2-nitrophenyl)-4-methylpentyl]piperazine (PubChem CID 171311221) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[(1R)-1-(4,5-dimethoxy-2-nitrophenyl)-4-methylpentyl]piperazine.
| Compound Name | 1-[(1R)-1-(4,5-dimethoxy-2-nitrophenyl)-4-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171311221 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 1-[(1R)-1-(4,5-dimethoxy-2-nitrophenyl)-4-methylpentyl]piperazine |
| SMILES | COc1cc([C@@H](CCC(C)C)N2CCNCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H29N3O4/c1-13(2)5-6-15(20-9-7-19-8-10-20)14-11-17(24-3)18(25-4)12-16(14)21(22)23/h11-13,15,19H,5-10H2,1-4H3/t15-/m1/s1 |
| InChIKey | XDEXKSOPYRBAOW-OAHLLOKOSA-N |
| XLogP | 2.99 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|