C16H25Cl2N3O4 — CID 171282435
1-[(1S)-1-(4,5-dimethoxy-2-nitrophenyl)but-3-enyl]piperazine;dihydrochloride (PubChem CID 171282435) has the molecular formula C16H25Cl2N3O4 and a molecular weight of 394.30 g/mol. Its IUPAC name is 1-[(1S)-1-(4,5-dimethoxy-2-nitrophenyl)but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(4,5-dimethoxy-2-nitrophenyl)but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171282435 |
| Molecular Formula | C16H25Cl2N3O4 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[(1S)-1-(4,5-dimethoxy-2-nitrophenyl)but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=CC[C@@H](c1cc(OC)c(OC)cc1[N+](=O)[O-])N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H23N3O4.2ClH/c1-4-5-13(18-8-6-17-7-9-18)12-10-15(22-2)16(23-3)11-14(12)19(20)21;;/h4,10-11,13,17H,1,5-9H2,2-3H3;2*1H/t13-;;/m0../s1 |
| InChIKey | FRWWIKZZYIBZPE-GXKRWWSZSA-N |
| XLogP | 2.98 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|