C17H21N3O4S — CID 171282444
1-[(R)-(4,5-dimethoxy-2-nitrophenyl)-thiophen-2-ylmethyl]piperazine (PubChem CID 171282444) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-[(R)-(4,5-dimethoxy-2-nitrophenyl)-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-[(R)-(4,5-dimethoxy-2-nitrophenyl)-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171282444 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[(R)-(4,5-dimethoxy-2-nitrophenyl)-thiophen-2-ylmethyl]piperazine |
| SMILES | COc1cc([C@H](c2cccs2)N2CCNCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H21N3O4S/c1-23-14-10-12(13(20(21)22)11-15(14)24-2)17(16-4-3-9-25-16)19-7-5-18-6-8-19/h3-4,9-11,17-18H,5-8H2,1-2H3/t17-/m1/s1 |
| InChIKey | PSWUIHXDRPVNPE-QGZVFWFLSA-N |
| XLogP | 2.67 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|