C17H25N3O4 — CID 171282438
1-[(S)-cyclobutyl-(4,5-dimethoxy-2-nitrophenyl)methyl]piperazine (PubChem CID 171282438) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-(4,5-dimethoxy-2-nitrophenyl)methyl]piperazine.
| Compound Name | 1-[(S)-cyclobutyl-(4,5-dimethoxy-2-nitrophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171282438 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[(S)-cyclobutyl-(4,5-dimethoxy-2-nitrophenyl)methyl]piperazine |
| SMILES | COc1cc([C@H](C2CCC2)N2CCNCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H25N3O4/c1-23-15-10-13(14(20(21)22)11-16(15)24-2)17(12-4-3-5-12)19-8-6-18-7-9-19/h10-12,17-18H,3-9H2,1-2H3/t17-/m0/s1 |
| InChIKey | IBTRXYIKNWWFNR-KRWDZBQOSA-N |
| XLogP | 2.36 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|