C21H29NO5 — CID 170870605
4-[3-(2,3,6,7-tetramethoxynaphthalen-1-yl)propyl]morpholine (PubChem CID 170870605) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[3-(2,3,6,7-tetramethoxynaphthalen-1-yl)propyl]morpholine.
| Compound Name | 4-[3-(2,3,6,7-tetramethoxynaphthalen-1-yl)propyl]morpholine |
|---|---|
| PubChem CID | 170870605 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 4-[3-(2,3,6,7-tetramethoxynaphthalen-1-yl)propyl]morpholine |
| SMILES | COc1cc2cc(OC)c(OC)c(CCCN3CCOCC3)c2cc1OC |
| InChI | InChI=1S/C21H29NO5/c1-23-18-12-15-13-20(25-3)21(26-4)16(17(15)14-19(18)24-2)6-5-7-22-8-10-27-11-9-22/h12-14H,5-11H2,1-4H3 |
| InChIKey | CYNUGSLEOQLHFX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |