C14H19N3O7 — CID 170869412
6-methoxy-3-(3-morpholin-4-ylpropyl)-2,4-dinitrophenol (PubChem CID 170869412) has the molecular formula C14H19N3O7 and a molecular weight of 341.32 g/mol. Its IUPAC name is 6-methoxy-3-(3-morpholin-4-ylpropyl)-2,4-dinitrophenol.
| Compound Name | 6-methoxy-3-(3-morpholin-4-ylpropyl)-2,4-dinitrophenol |
|---|---|
| PubChem CID | 170869412 |
| Molecular Formula | C14H19N3O7 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 6-methoxy-3-(3-morpholin-4-ylpropyl)-2,4-dinitrophenol |
| SMILES | COc1cc([N+](=O)[O-])c(CCCN2CCOCC2)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C14H19N3O7/c1-23-12-9-11(16(19)20)10(13(14(12)18)17(21)22)3-2-4-15-5-7-24-8-6-15/h9,18H,2-8H2,1H3 |
| InChIKey | DVCIHSGVBCVFOU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|