C29H27FN4O4 — CID 156695728
3-amino-4-[4-[[5-fluoro-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-2-methoxyphenoxy]benzonitrile (PubChem CID 156695728) has the molecular formula C29H27FN4O4 and a molecular weight of 514.56 g/mol. Its IUPAC name is 3-amino-4-[4-[[5-fluoro-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-2-methoxyphenoxy]benzonitrile.
| Compound Name | 3-amino-4-[4-[[5-fluoro-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-2-methoxyphenoxy]benzonitrile |
|---|---|
| PubChem CID | 156695728 |
| Molecular Formula | C29H27FN4O4 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 3-amino-4-[4-[[5-fluoro-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-2-methoxyphenoxy]benzonitrile |
| SMILES | COc1cc(C=C2C(=O)N(CCN3CCOCC3)c3ccc(F)cc32)ccc1Oc1ccc(C#N)cc1N |
| InChI | InChI=1S/C29H27FN4O4/c1-36-28-16-19(2-7-27(28)38-26-6-3-20(18-31)15-24(26)32)14-23-22-17-21(30)4-5-25(22)34(29(23)35)9-8-33-10-12-37-13-11-33/h2-7,14-17H,8-13,32H2,1H3 |
| InChIKey | WLBFVFFWXAGLOD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|