C26H22N2O4 — CID 127048264
(3Z)-3-[[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-1H-indol-2-one (PubChem CID 127048264) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is (3Z)-3-[[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 127048264 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (3Z)-3-[[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C2\C(=O)Nc3ccccc32)ccc1OCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C26H22N2O4/c1-31-24-15-17(14-20-19-7-3-4-8-21(19)27-26(20)30)10-11-23(24)32-16-25(29)28-13-12-18-6-2-5-9-22(18)28/h2-11,14-15H,12-13,16H2,1H3,(H,27,30)/b20-14- |
| InChIKey | WASLAAAVEUSMKE-ZHZULCJRSA-N |
| XLogP | 4.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|