C24H29N3O3 — CID 155534163
(3Z)-3-[[3-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methylidene]-1H-indol-2-one (PubChem CID 155534163) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is (3Z)-3-[[3-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 155534163 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (3Z)-3-[[3-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C2\C(=O)Nc3ccccc32)ccc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C24H29N3O3/c1-26-11-13-27(14-12-26)10-5-15-30-22-9-8-18(17-23(22)29-2)16-20-19-6-3-4-7-21(19)25-24(20)28/h3-4,6-9,16-17H,5,10-15H2,1-2H3,(H,25,28)/b20-16- |
| InChIKey | PNFWBZCKLAHHSO-SILNSSARSA-N |
| XLogP | 3.20 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|