C23H26N2O4 — CID 155530976
(3Z)-3-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-5-methyl-1H-indol-2-one (PubChem CID 155530976) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (3Z)-3-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-5-methyl-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-5-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 155530976 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (3Z)-3-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-5-methyl-1H-indol-2-one |
| SMILES | COc1cc(/C=C2\C(=O)Nc3ccc(C)cc32)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C23H26N2O4/c1-16-3-5-20-18(13-16)19(23(26)24-20)14-17-4-6-21(22(15-17)27-2)29-12-9-25-7-10-28-11-8-25/h3-6,13-15H,7-12H2,1-2H3,(H,24,26)/b19-14- |
| InChIKey | LQGTZROXOSGDKH-RGEXLXHISA-N |
| XLogP | 3.21 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|