C26H37N3O4 — CID 123576734
5-[2-[2-(4-ethyl-2-methoxyphenoxy)ethylamino]propyl]-1-(3-hydroxypropyl)-2,3-dihydroindole-7-carboxamide (PubChem CID 123576734) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is 5-[2-[2-(4-ethyl-2-methoxyphenoxy)ethylamino]propyl]-1-(3-hydroxypropyl)-2,3-dihydroindole-7-carboxamide.
| Compound Name | 5-[2-[2-(4-ethyl-2-methoxyphenoxy)ethylamino]propyl]-1-(3-hydroxypropyl)-2,3-dihydroindole-7-carboxamide |
|---|---|
| PubChem CID | 123576734 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 5-[2-[2-(4-ethyl-2-methoxyphenoxy)ethylamino]propyl]-1-(3-hydroxypropyl)-2,3-dihydroindole-7-carboxamide |
| SMILES | CCc1ccc(OCCNC(C)Cc2cc3c(c(C(N)=O)c2)N(CCCO)CC3)c(OC)c1 |
| InChI | InChI=1S/C26H37N3O4/c1-4-19-6-7-23(24(17-19)32-3)33-13-9-28-18(2)14-20-15-21-8-11-29(10-5-12-30)25(21)22(16-20)26(27)31/h6-7,15-18,28,30H,4-5,8-14H2,1-3H3,(H2,27,31) |
| InChIKey | PFIXDWMGJBBKLT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|