C26H36ClN3O4 — CID 123631829
5-[2-[2-(4-chloro-2-ethoxyphenoxy)ethylamino]propyl]-1-(3-hydroxypropyl)-2-methyl-2,3-dihydroindole-7-carboxamide (PubChem CID 123631829) has the molecular formula C26H36ClN3O4 and a molecular weight of 490.04 g/mol. Its IUPAC name is 5-[2-[2-(4-chloro-2-ethoxyphenoxy)ethylamino]propyl]-1-(3-hydroxypropyl)-2-methyl-2,3-dihydroindole-7-carboxamide.
| Compound Name | 5-[2-[2-(4-chloro-2-ethoxyphenoxy)ethylamino]propyl]-1-(3-hydroxypropyl)-2-methyl-2,3-dihydroindole-7-carboxamide |
|---|---|
| PubChem CID | 123631829 |
| Molecular Formula | C26H36ClN3O4 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 5-[2-[2-(4-chloro-2-ethoxyphenoxy)ethylamino]propyl]-1-(3-hydroxypropyl)-2-methyl-2,3-dihydroindole-7-carboxamide |
| SMILES | CCOc1cc(Cl)ccc1OCCNC(C)Cc1cc2c(c(C(N)=O)c1)N(CCCO)C(C)C2 |
| InChI | InChI=1S/C26H36ClN3O4/c1-4-33-24-16-21(27)6-7-23(24)34-11-8-29-17(2)12-19-14-20-13-18(3)30(9-5-10-31)25(20)22(15-19)26(28)32/h6-7,14-18,29,31H,4-5,8-13H2,1-3H3,(H2,28,32) |
| InChIKey | CHFRTGNEDHOQFO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|