C27H34FN3O4 — CID 86343237
5-[(2R)-2-[2-[2-(cyclopropylmethoxy)-4-fluorophenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide (PubChem CID 86343237) has the molecular formula C27H34FN3O4 and a molecular weight of 483.58 g/mol. Its IUPAC name is 5-[(2R)-2-[2-[2-(cyclopropylmethoxy)-4-fluorophenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide.
| Compound Name | 5-[(2R)-2-[2-[2-(cyclopropylmethoxy)-4-fluorophenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
|---|---|
| PubChem CID | 86343237 |
| Molecular Formula | C27H34FN3O4 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 5-[(2R)-2-[2-[2-(cyclopropylmethoxy)-4-fluorophenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
| SMILES | C[C@H](Cc1cc(C(N)=O)c2c(ccn2CCCO)c1)NCCOc1ccc(F)cc1OCC1CC1 |
| InChI | InChI=1S/C27H34FN3O4/c1-18(30-8-12-34-24-6-5-22(28)16-25(24)35-17-19-3-4-19)13-20-14-21-7-10-31(9-2-11-32)26(21)23(15-20)27(29)33/h5-7,10,14-16,18-19,30,32H,2-4,8-9,11-13,17H2,1H3,(H2,29,33)/t18-/m1/s1 |
| InChIKey | GLVSRZMCGNAKTE-GOSISDBHSA-N |
| XLogP | 3.65 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|