C27H34F3N3O4 — CID 139672139
1-(3-hydroxypropyl)-N,N-dimethyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indole-7-carboxamide (PubChem CID 139672139) has the molecular formula C27H34F3N3O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-N,N-dimethyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indole-7-carboxamide.
| Compound Name | 1-(3-hydroxypropyl)-N,N-dimethyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indole-7-carboxamide |
|---|---|
| PubChem CID | 139672139 |
| Molecular Formula | C27H34F3N3O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 1-(3-hydroxypropyl)-N,N-dimethyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indole-7-carboxamide |
| SMILES | CC(Cc1cc(C(=O)N(C)C)c2c(ccn2CCCO)c1)NCCOc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C27H34F3N3O4/c1-19(31-10-14-36-23-7-4-5-8-24(23)37-18-27(28,29)30)15-20-16-21-9-12-33(11-6-13-34)25(21)22(17-20)26(35)32(2)3/h4-5,7-9,12,16-17,19,31,34H,6,10-11,13-15,18H2,1-3H3 |
| InChIKey | AYGDRJOYVITQJN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|