C30H39N3O4 — CID 86344540
5-[(2R)-2-[2-[2-(cyclopropylmethoxy)-4-prop-2-enylphenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide (PubChem CID 86344540) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is 5-[(2R)-2-[2-[2-(cyclopropylmethoxy)-4-prop-2-enylphenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide.
| Compound Name | 5-[(2R)-2-[2-[2-(cyclopropylmethoxy)-4-prop-2-enylphenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
|---|---|
| PubChem CID | 86344540 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 5-[(2R)-2-[2-[2-(cyclopropylmethoxy)-4-prop-2-enylphenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
| SMILES | C=CCc1ccc(OCCN[C@H](C)Cc2cc(C(N)=O)c3c(ccn3CCCO)c2)c(OCC2CC2)c1 |
| InChI | InChI=1S/C30H39N3O4/c1-3-5-22-8-9-27(28(19-22)37-20-23-6-7-23)36-15-11-32-21(2)16-24-17-25-10-13-33(12-4-14-34)29(25)26(18-24)30(31)35/h3,8-10,13,17-19,21,23,32,34H,1,4-7,11-12,14-16,20H2,2H3,(H2,31,35)/t21-/m1/s1 |
| InChIKey | QALNYJOQIBQOIK-OAQYLSRUSA-N |
| XLogP | 4.24 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|