C26H34FN3O4 — CID 123161319
3-[7-[amino(hydroxy)methyl]-5-[2-[2-(2-cyclopropyloxy-4-fluorophenoxy)ethylamino]propyl]indol-1-yl]propan-1-ol (PubChem CID 123161319) has the molecular formula C26H34FN3O4 and a molecular weight of 471.57 g/mol. Its IUPAC name is 3-[7-[amino(hydroxy)methyl]-5-[2-[2-(2-cyclopropyloxy-4-fluorophenoxy)ethylamino]propyl]indol-1-yl]propan-1-ol.
| Compound Name | 3-[7-[amino(hydroxy)methyl]-5-[2-[2-(2-cyclopropyloxy-4-fluorophenoxy)ethylamino]propyl]indol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 123161319 |
| Molecular Formula | C26H34FN3O4 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 3-[7-[amino(hydroxy)methyl]-5-[2-[2-(2-cyclopropyloxy-4-fluorophenoxy)ethylamino]propyl]indol-1-yl]propan-1-ol |
| SMILES | CC(Cc1cc(C(N)O)c2c(ccn2CCCO)c1)NCCOc1ccc(F)cc1OC1CC1 |
| InChI | InChI=1S/C26H34FN3O4/c1-17(29-8-12-33-23-6-3-20(27)16-24(23)34-21-4-5-21)13-18-14-19-7-10-30(9-2-11-31)25(19)22(15-18)26(28)32/h3,6-7,10,14-17,21,26,29,31-32H,2,4-5,8-9,11-13,28H2,1H3 |
| InChIKey | HLNIZYLGAIVDRD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|