C21H30ClFN2O5S — CID 22157065
2-ethoxy-5-[2-[2-(2-ethoxy-5-fluorophenoxy)ethylamino]propyl]benzenesulfonamide;hydrochloride (PubChem CID 22157065) has the molecular formula C21H30ClFN2O5S and a molecular weight of 477.00 g/mol. Its IUPAC name is 2-ethoxy-5-[2-[2-(2-ethoxy-5-fluorophenoxy)ethylamino]propyl]benzenesulfonamide;hydrochloride.
| Compound Name | 2-ethoxy-5-[2-[2-(2-ethoxy-5-fluorophenoxy)ethylamino]propyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22157065 |
| Molecular Formula | C21H30ClFN2O5S |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 2-ethoxy-5-[2-[2-(2-ethoxy-5-fluorophenoxy)ethylamino]propyl]benzenesulfonamide;hydrochloride |
| SMILES | CCOc1ccc(F)cc1OCCNC(C)Cc1ccc(OCC)c(S(N)(=O)=O)c1.Cl |
| InChI | InChI=1S/C21H29FN2O5S.ClH/c1-4-27-18-9-7-17(22)14-20(18)29-11-10-24-15(3)12-16-6-8-19(28-5-2)21(13-16)30(23,25)26;/h6-9,13-15,24H,4-5,10-12H2,1-3H3,(H2,23,25,26);1H |
| InChIKey | BIWFNSMZOMKVCZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|