C19H25FN2O4S — CID 67896278
5-[2-[2-(3-fluoro-2-methylphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide (PubChem CID 67896278) has the molecular formula C19H25FN2O4S and a molecular weight of 396.48 g/mol. Its IUPAC name is 5-[2-[2-(3-fluoro-2-methylphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[2-[2-(3-fluoro-2-methylphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 67896278 |
| Molecular Formula | C19H25FN2O4S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 5-[2-[2-(3-fluoro-2-methylphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(CC(C)NCCOc2cccc(F)c2C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H25FN2O4S/c1-13(22-9-10-26-17-6-4-5-16(20)14(17)2)11-15-7-8-18(25-3)19(12-15)27(21,23)24/h4-8,12-13,22H,9-11H2,1-3H3,(H2,21,23,24) |
| InChIKey | ACYKXYIQXHEXSX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|