C22H31NO5S — CID 14676142
N-[2-(2-methoxyphenoxy)ethyl]-1-(4-methoxy-3-propan-2-ylsulfonylphenyl)propan-2-amine (PubChem CID 14676142) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-1-(4-methoxy-3-propan-2-ylsulfonylphenyl)propan-2-amine.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-1-(4-methoxy-3-propan-2-ylsulfonylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 14676142 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-1-(4-methoxy-3-propan-2-ylsulfonylphenyl)propan-2-amine |
| SMILES | COc1ccccc1OCCNC(C)Cc1ccc(OC)c(S(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C22H31NO5S/c1-16(2)29(24,25)22-15-18(10-11-21(22)27-5)14-17(3)23-12-13-28-20-9-7-6-8-19(20)26-4/h6-11,15-17,23H,12-14H2,1-5H3 |
| InChIKey | VYPYIYKIYZCPNX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|