C19H24NO4S- — CID 57264438
5-[2-[2-(2-methoxyphenoxy)ethylamino]propyl]-2-methylbenzenesulfinate (PubChem CID 57264438) has the molecular formula C19H24NO4S- and a molecular weight of 362.47 g/mol. Its IUPAC name is 5-[2-[2-(2-methoxyphenoxy)ethylamino]propyl]-2-methylbenzenesulfinate.
| Compound Name | 5-[2-[2-(2-methoxyphenoxy)ethylamino]propyl]-2-methylbenzenesulfinate |
|---|---|
| PubChem CID | 57264438 |
| Molecular Formula | C19H24NO4S- |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 5-[2-[2-(2-methoxyphenoxy)ethylamino]propyl]-2-methylbenzenesulfinate |
| SMILES | COc1ccccc1OCCNC(C)Cc1ccc(C)c(S(=O)[O-])c1 |
| InChI | InChI=1S/C19H25NO4S/c1-14-8-9-16(13-19(14)25(21)22)12-15(2)20-10-11-24-18-7-5-4-6-17(18)23-3/h4-9,13,15,20H,10-12H2,1-3H3,(H,21,22)/p-1 |
| InChIKey | JJSLMKRIYXQGDF-UHFFFAOYSA-M |
| XLogP | 2.84 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|