C22H30N2O9S — CID 25009120
5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;oxalic acid (PubChem CID 25009120) has the molecular formula C22H30N2O9S and a molecular weight of 498.55 g/mol. Its IUPAC name is 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;oxalic acid.
| Compound Name | 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;oxalic acid |
|---|---|
| PubChem CID | 25009120 |
| Molecular Formula | C22H30N2O9S |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;oxalic acid |
| SMILES | CCOc1ccccc1OCCN[C@H](C)Cc1ccc(OC)c(S(N)(=O)=O)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H28N2O5S.C2H2O4/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24;3-1(4)2(5)6/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24);(H,3,4)(H,5,6)/t15-;/m1./s1 |
| InChIKey | UHVDQWYZTKMJHK-XFULWGLBSA-N |
| XLogP | 1.50 |
| TPSA | 174.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|