C18H24N2O4S — CID 96869335
2-methoxy-5-[(2R)-2-(2-phenoxyethylamino)propyl]benzenesulfonamide (PubChem CID 96869335) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-methoxy-5-[(2R)-2-(2-phenoxyethylamino)propyl]benzenesulfonamide.
| Compound Name | 2-methoxy-5-[(2R)-2-(2-phenoxyethylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 96869335 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-methoxy-5-[(2R)-2-(2-phenoxyethylamino)propyl]benzenesulfonamide |
| SMILES | COc1ccc(C[C@@H](C)NCCOc2ccccc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C18H24N2O4S/c1-14(20-10-11-24-16-6-4-3-5-7-16)12-15-8-9-17(23-2)18(13-15)25(19,21)22/h3-9,13-14,20H,10-12H2,1-2H3,(H2,19,21,22)/t14-/m1/s1 |
| InChIKey | UERLZSSAWHCYEK-CQSZACIVSA-N |
| XLogP | 1.94 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|