C27H36N2O8S2 — CID 87844412
5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;4-methylbenzenesulfonic acid (PubChem CID 87844412) has the molecular formula C27H36N2O8S2 and a molecular weight of 580.73 g/mol. Its IUPAC name is 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;4-methylbenzenesulfonic acid.
| Compound Name | 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87844412 |
| Molecular Formula | C27H36N2O8S2 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;4-methylbenzenesulfonic acid |
| SMILES | CCOc1ccccc1OCCN[C@H](C)Cc1ccc(OC)c(S(N)(=O)=O)c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H28N2O5S.C7H8O3S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24;1-6-2-4-7(5-3-6)11(8,9)10/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24);2-5H,1H3,(H,8,9,10)/t15-;/m1./s1 |
| InChIKey | PHSQNXFQGBVDOI-XFULWGLBSA-N |
| XLogP | 3.58 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|