C30H44N2O9S2 — CID 20747894
[(1R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide (PubChem CID 20747894) has the molecular formula C30H44N2O9S2 and a molecular weight of 640.82 g/mol. Its IUPAC name is [(1R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide.
| Compound Name | [(1R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 20747894 |
| Molecular Formula | C30H44N2O9S2 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | [(1R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide |
| SMILES | CC1(C)C2CC[C@]1(CS(=O)(=O)O)C(=O)C2.CCOc1ccccc1OCCN[C@H](C)Cc1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H28N2O5S.C10H16O4S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24);7H,3-6H2,1-2H3,(H,12,13,14)/t15-;7?,10-/m10/s1 |
| InChIKey | FATAUKZYLUTXMK-VWGLGKMJSA-N |
| XLogP | 3.61 |
| TPSA | 171.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|