C20H29ClN2O6S — CID 87960691
N-chloro-5-[2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;hydrate (PubChem CID 87960691) has the molecular formula C20H29ClN2O6S and a molecular weight of 460.98 g/mol. Its IUPAC name is N-chloro-5-[2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;hydrate.
| Compound Name | N-chloro-5-[2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;hydrate |
|---|---|
| PubChem CID | 87960691 |
| Molecular Formula | C20H29ClN2O6S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-chloro-5-[2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;hydrate |
| SMILES | CCOc1ccccc1OCCNC(C)Cc1ccc(OC)c(S(=O)(=O)NCl)c1.O |
| InChI | InChI=1S/C20H27ClN2O5S.H2O/c1-4-27-17-7-5-6-8-18(17)28-12-11-22-15(2)13-16-9-10-19(26-3)20(14-16)29(24,25)23-21;/h5-10,14-15,22-23H,4,11-13H2,1-3H3;1H2 |
| InChIKey | PZTPBOJYIVRVDT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|