C24H33FN2O9S — CID 22157080
5-[2-[2-(2-ethoxy-5-fluorophenoxy)ethylamino]propyl]-2-methoxy-N,N-dimethylbenzenesulfonamide;oxalic acid (PubChem CID 22157080) has the molecular formula C24H33FN2O9S and a molecular weight of 544.60 g/mol. Its IUPAC name is 5-[2-[2-(2-ethoxy-5-fluorophenoxy)ethylamino]propyl]-2-methoxy-N,N-dimethylbenzenesulfonamide;oxalic acid.
| Compound Name | 5-[2-[2-(2-ethoxy-5-fluorophenoxy)ethylamino]propyl]-2-methoxy-N,N-dimethylbenzenesulfonamide;oxalic acid |
|---|---|
| PubChem CID | 22157080 |
| Molecular Formula | C24H33FN2O9S |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 5-[2-[2-(2-ethoxy-5-fluorophenoxy)ethylamino]propyl]-2-methoxy-N,N-dimethylbenzenesulfonamide;oxalic acid |
| SMILES | CCOc1ccc(F)cc1OCCNC(C)Cc1ccc(OC)c(S(=O)(=O)N(C)C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H31FN2O5S.C2H2O4/c1-6-29-19-10-8-18(23)15-21(19)30-12-11-24-16(2)13-17-7-9-20(28-5)22(14-17)31(26,27)25(3)4;3-1(4)2(5)6/h7-10,14-16,24H,6,11-13H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | BYCABDKKTYUQTK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|